
Catalog Number	AR00DY6T
Chemical Name	HOMO-GAMMA-LINOLEICACID
CAS Number	5598-38-9
Molecular Formula	C20H36O2
Molecular Weight	308.4986
MDL Number	MFCD02664569
SMILES	CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)O

The Homo-γ-linoleic acid is a valuable compound in chemical synthesis, serving as a key precursor in the production of various important chemicals. Its applications in chemical synthesis are vast and diverse, with its unique molecular structure contributing to the development of a wide range of products. From pharmaceuticals to industrial materials, Homo-γ-linoleic acid plays a crucial role in the creation of new compounds with specific properties and functions. Its versatility and reactivity make it a highly sought-after ingredient in the field of chemical synthesis, enabling the synthesis of complex molecules that are essential for various industries.