
Catalog Number	AR00DONF
Chemical Name	Benzoic acid, 4-cyano-, 1,1-diMethylethyl ester
CAS Number	55696-50-9
Molecular Formula	C12H13NO2
Molecular Weight	203.2371
MDL Number	MFCD11041298
SMILES	N#Cc1ccc(cc1)C(=O)OC(C)(C)C
NSC Number	114973

The tert-Butyl 4-cyanobenzoate is a versatile compound that finds wide application in chemical synthesis. Its unique structure and reactivity make it a valuable building block in the creation of various organic molecules. One of the key uses of tert-Butyl 4-cyanobenzoate is as a precursor in the synthesis of pharmaceuticals and agrochemicals. Its incorporation into target molecules allows for the introduction of specific functional groups that are crucial for the desired biological activity. Furthermore, tert-Butyl 4-cyanobenzoate can be employed in the formation of complex organic frameworks through various coupling reactions, such as Suzuki-Miyaura and Sonogashira cross-coupling. This compound's ability to undergo diverse transformations makes it a valuable tool for synthetic chemists aiming to access a wide range of structurally diverse compounds with potential applications in the fields of medicinal chemistry and materials science.