
Catalog Number	AR00E1Q4
Chemical Name	2-(3-nitrophenyl)-1,3,4-oxadiazole
CAS Number	5565-72-0
Molecular Formula	C8H5N3O3
Molecular Weight	191.1436
MDL Number	MFCD00085145
SMILES	[O-][N+](=O)c1cccc(c1)c1nnco1

2-(3-nitrophenyl)-1,3,4-oxadiazole is a versatile compound that finds application in various chemical synthesis processes. As a key intermediate, it plays a crucial role in the creation of diverse organic compounds. With its unique structure and reactivity, this compound serves as a valuable building block for the synthesis of pharmaceuticals, agrochemicals, and materials with specialized properties. In chemical synthesis, 2-(3-nitrophenyl)-1,3,4-oxadiazole is frequently employed as a precursor for the modification of functional groups, allowing for the introduction of specific characteristics or functionalities into the final product. Its compatibility with a wide range of reaction conditions and its ability to undergo various transformations make it a preferred choice for synthetic chemists working on the development of novel compounds.