
Catalog Number	AR00DKWY
Chemical Name	Dansylcadaverine didansylcadaverine
CAS Number	55521-24-9
Molecular Formula	C29H36N4O4S2
Molecular Weight	568.7505
MDL Number	MFCD00056585
SMILES	CN(c1cccc2c1cccc2S(=O)(=O)NCCCCCNS(=O)(=O)c1cccc2c1cccc2N(C)C)C

Didansylcadaverine is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. In organic chemistry, Didansylcadaverine is commonly utilized as a fluorescent probe for detecting and quantifying amino groups, making it a valuable tool for studying protein structure and function. Furthermore, this compound serves as a key building block in the synthesis of various complex molecules, including peptides and small organic molecules. Its ability to selectively react with specific functional groups makes Didansylcadaverine an indispensable reagent in the development of novel materials and pharmaceuticals. By incorporating Didansylcadaverine into synthetic pathways, chemists can efficiently access a wide range of structurally diverse compounds with tailored properties for numerous applications in biology, medicine, and materials science.