
Catalog Number	AR00DDRV
Chemical Name	1-[[3-(Trifluoromethyl)phenyl]methyl]piperazine
CAS Number	55513-16-1
Molecular Formula	C12H15F3N2
Molecular Weight	244.2561096000001
MDL Number	MFCD04967284
SMILES	FC(c1cccc(c1)CN1CCNCC1)(F)F

1-[3-(trifluoromethyl)benzyl]piperazine is a versatile compound widely used in chemical synthesis as a key building block for the development of pharmaceuticals, agrochemicals, and other fine chemicals. In organic synthesis, this compound serves as a valuable intermediate due to its unique structural properties and reactivity. Through various chemical reactions such as acylation, alkylation, and nucleophilic substitution, 1-[3-(trifluoromethyl)benzyl]piperazine can be further modified to create a diverse range of functionalized molecules with specific biological activities or properties. This compound's trifluoromethyl group confers enhanced lipophilicity and stability to the resulting products, making it particularly advantageous for drug discovery and development efforts targeting various therapeutic areas.