
Catalog Number	AR00IALI
Chemical Name	Jujuboside B
CAS Number	55466-05-2
Molecular Formula	C52H84O21
Molecular Weight	1045.2108
MDL Number	MFCD03427710
SMILES	OC[C@H]1O[C@@H](O[C@H]2[C@@H](O)CO[C@H]([C@@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC[C@H]3[C@@]42CO[C@]2(C4)[C@@H]3[C@@](C)(O)C[C@@H](O2)C=C(C)C)C)C)[C@@H]([C@H]([C@@H]1O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O

Jujuboside B, a natural compound extracted from the seeds of the jujube tree, is a versatile molecule that finds wide application in chemical synthesis. As a triterpenoid saponin, Jujuboside B possesses unique structural characteristics that make it an attractive choice for chemists looking to perform various reactions and transformations.In the realm of chemical synthesis, Jujuboside B serves as a valuable starting material for the production of bioactive compounds, pharmaceuticals, and functional materials. Its complex and functionalized structure allows for diverse functional group manipulations, enabling chemists to introduce specific modifications and create novel derivatives with desired properties.One of the notable applications of Jujuboside B in chemical synthesis is its role as a key intermediate in the synthesis of natural product derivatives with potential therapeutic applications. By utilizing the structural framework of Jujuboside B as a scaffold, chemists can efficiently build upon its molecular architecture to access analogs or derivatives that exhibit enhanced biological activity or improved pharmacokinetic profiles.Moreover, Jujuboside B can also be utilized as a chiral building block in asymmetric synthesis, where its stereochemical integrity enables the creation of enantiomerically pure compounds. This aspect is particularly important in medicinal chemistry and drug development, where the stereochemistry of a molecule can significantly impact its biological interactions and efficacy.Overall, the versatility and synthetic utility of Jujuboside B make it a valuable asset in the toolkit of synthetic chemists, offering opportunities for innovation and advancement in the field of organic synthesis.