
Catalog Number	AR00D8LX
Chemical Name	LINAMARIN
CAS Number	554-35-8
Molecular Formula	C10H17NO6
Molecular Weight	247.2451
MDL Number	MFCD00036209
SMILES	OC[C@H]1O[C@@H](OC(C#N)(C)C)[C@@H]([C@H]([C@@H]1O)O)O

Linamarin, a naturally occurring cyanogenic glycoside found in various plant species, serves a crucial role in chemical synthesis, particularly in the production of cyanide compounds and related chemicals. When subjected to hydrolysis, Linamarin releases hydrogen cyanide, which can then be utilized as a building block for numerous synthetic processes. This compound's ability to generate cyanide under controlled conditions makes it valuable in the development of pharmaceuticals, agrochemicals, and materials science. In addition, Linamarin's unique chemical properties make it a versatile precursor for the creation of specialized compounds used in various industries and research applications.