
Catalog Number	AR01DHCT
Chemical Name	2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-([1,1-biphenyl]-4-yl)propanoic acid
CAS Number	553643-52-0
Molecular Formula	C30H25NO4
Molecular Weight	463.5238
MDL Number	MFCD03425236
SMILES	O=C(NC(C(=O)O)Cc1ccc(cc1)c1ccccc1)OCC1c2ccccc2c2c1cccc2

The compound 2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-([1,1-biphenyl]-4-yl)propanoic acid plays a crucial role in chemical synthesis as a versatile building block. Its unique structure containing both fluorene and biphenyl moieties imparts specific reactivity and properties that make it valuable in the preparation of complex molecules. In organic synthesis, this compound can serve as a key intermediate for the synthesis of various pharmaceuticals, agrochemicals, and materials. Its ability to undergo selective functionalization and form stable intermediates enables chemists to introduce specific functionalities at precise positions within a molecule, facilitating the synthesis of diverse compounds with tailored properties. Additionally, the presence of both fluorene and biphenyl groups in the molecule can influence the compound's structural rigidity and electronic properties, making it useful in designing molecules with desired conformational constraints or electronic effects.