
Catalog Number	AR00D9HU
Chemical Name	Larocaine hydrochloride
CAS Number	553-63-9
Molecular Formula	C16H27ClN2O2
Molecular Weight	314.8508
MDL Number	MFCD01697031
SMILES	CCN(CC(COC(=O)c1ccc(cc1)N)(C)C)CC.Cl

The application of 3-(Diethylamino)-2,2-dimethylpropyl 4-aminobenzoate hydrochloride in chemical synthesis lies primarily in its role as a versatile reagent for the synthesis of various organic molecules. This compound serves as a valuable precursor in the production of complex organic compounds due to its reactivity and structural properties. In chemical synthesis, it can be employed as a key building block or intermediate in the creation of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, its specific functional groups and stability make it a useful tool for the modification of existing chemical structures, enabling the synthesis of new compounds with tailored properties and functionalities.