
Catalog Number	AR01DQVZ
Chemical Name	Erythromycin, cyclic 11,12-carbonate
CAS Number	55224-05-0
Molecular Formula	C38H65NO14
Molecular Weight	759.921
MDL Number	MFCD01729176
SMILES	CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@@H]2O[C@@H](C)[C@@H]([C@](C2)(C)OC)O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C[C@H](C(=O)[C@@H]([C@@H]2[C@]1(C)OC(=O)O2)C)C)(C)O

The compound $name$ functions as a versatile building block in chemical synthesis, particularly in the synthesis of complex organic molecules. With its unique configuration, it serves as a key intermediate in the creation of intricate structures, allowing for the formation of diverse chemical compounds. Specifically, $name$ plays a crucial role in the development of novel pharmaceuticals, agrochemicals, and materials with tailored properties. Its strategic placement and functional groups contribute to its significance as a valuable tool for organic chemists seeking to achieve specific molecular arrangements and functionalities in their target compounds.