
Catalog Number	AR00DDFH
Chemical Name	2-AMINO-6,7-DIMETHOXY-QUINOLINE-3-CARBOXYLIC ACID AMIDE
CAS Number	55149-43-4
Molecular Formula	C12H13N3O3
Molecular Weight	247.2499
MDL Number	MFCD00815945
SMILES	COc1cc2nc(N)c(cc2cc1OC)C(=O)N

2-Amino-6,7-dimethoxyquinoline-3-carboxamide is a versatile compound that finds widespread application in chemical synthesis. As a key intermediate in organic chemistry, this compound serves as a building block for the synthesis of various heterocyclic compounds and pharmaceutical agents. With its unique structural features, 2-Amino-6,7-dimethoxyquinoline-3-carboxamide offers chemists a strategic starting material for the development of novel molecules with potential therapeutic properties. Its inclusion in synthetic routes allows for the efficient construction of complex structures, enabling researchers to explore new avenues in drug discovery and material science. In addition, the presence of a carboxamide functional group in this compound facilitates further derivatization, leading to the generation of diverse molecular libraries for screening purposes. Overall, the strategic utilization of 2-Amino-6,7-dimethoxyquinoline-3-carboxamide in chemical synthesis highlights its significance in advancing the field of organic chemistry and pharmaceutical research.