
Catalog Number	AR00DILQ
Chemical Name	METHYL 7-BROMO-1-BENZOTHIOPHENE-2-CARBOXYLATE
CAS Number	550998-53-3
Molecular Formula	C10H7BrO2S
Molecular Weight	271.1304
MDL Number	MFCD09027095
SMILES	COC(=O)c1cc2c(s1)c(Br)ccc2

Methyl 7-bromobenzo[b]thiophene-2-carboxylate serves as a versatile building block in chemical synthesis, frequently employed for the creation of heterocyclic compounds. This compound is particularly valuable in the development of pharmaceuticals, agrochemicals, and materials due to its unique structural properties. Its ability to participate in various reactions, such as Suzuki couplings and nucleophilic substitutions, enables the efficient formation of complex molecular structures. By incorporating Methyl 7-bromobenzo[b]thiophene-2-carboxylate into synthetic routes, chemists can access a diverse array of novel compounds with potential applications in drug discovery and material science.