
Catalog Number	AR00DEX2
Chemical Name	L-Citrulline DL-Malate 2
CAS Number	54940-97-5
Molecular Formula	C10H19N3O8
Molecular Weight	309.2732
MDL Number	MFCD09839004
SMILES	OC(=O)CC(C(=O)O)O.NC(=O)NCCCC(C(=O)O)N

L-Citrulline DL-malate (1:1) is a versatile compound commonly used in chemical synthesis processes. Its unique structure allows it to participate in a variety of reactions, making it a valuable reagent in organic chemistry.One important application of L-Citrulline DL-malate (1:1) in chemical synthesis is as a precursor for the synthesis of other compounds. By selectively modifying different functional groups on the molecule, chemists can create diverse derivatives with specific properties. This versatility makes L-Citrulline DL-malate (1:1) a valuable building block for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals.Additionally, L-Citrulline DL-malate (1:1) can act as a chiral auxiliary in asymmetric synthesis. Its chiral nature allows it to influence the stereochemistry of reactions, enabling the production of enantiomerically pure compounds. This is crucial in the pharmaceutical industry, where the stereochemistry of a molecule can dramatically affect its biological activity.Overall, L-Citrulline DL-malate (1:1) plays a key role in chemical synthesis by serving as a versatile starting material and chiral building block for the creation of complex molecules with specific properties and stereochemistry.