
Catalog Number	AR00DF0O
Chemical Name	Diglycidyl 1,2-cyclohexanedicarboxylate
CAS Number	5493-45-8
Molecular Formula	C14H20O6
Molecular Weight	284.305
MDL Number	MFCD00128914
SMILES	O=C(C1CCCCC1C(=O)OCC1OC1)OCC1OC1

Bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate is a versatile compound widely used in chemical synthesis for its unique properties. In organic synthesis, it functions as a bifunctional reagent due to the presence of two epoxide functional groups. These epoxide groups can undergo ring-opening reactions with nucleophiles, enabling the introduction of various functional groups into molecules.Furthermore, Bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate can also act as a crosslinking agent in polymer chemistry. The epoxide groups can react with multiple polymer chains, leading to the formation of crosslinked polymer networks. This crosslinking capability is particularly useful in the production of adhesives, coatings, and composite materials with enhanced mechanical properties.Overall, the application of Bis(oxiran-2-ylmethyl) cyclohexane-1,2-dicarboxylate in chemical synthesis offers a wide range of possibilities for the modification and functionalization of organic compounds, making it a valuable tool for researchers and chemists in various fields.