
Catalog Number	AR00DAQW
Chemical Name	(R)-2-((R)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-YL)-2-PHENYL-ETHANOL
CAS Number	548443-18-1
Molecular Formula	C19H23NO3
Molecular Weight	313.3908
SMILES	OC[C@@H]([C@H]1NCCc2c1cc(OC)c(c2)OC)c1ccccc1

The compound (R*)-2-((R*)-6,7-DIMETHOXY-1,2,3,4-TETRAHYDRO-ISOQUINOLIN-1-YL)-2-PHENYL-ETHANOL, also known as $name$, serves as a valuable chiral building block in chemical synthesis. Due to its unique stereochemistry and functional groups, this compound is particularly useful in asymmetric synthesis processes. By incorporating $name$ into reaction schemes, chemists can introduce chirality with precision, enabling the creation of enantiomerically enriched molecules. This compound can be utilized in the synthesis of pharmaceutical intermediates, natural product derivatives, and other complex organic compounds where stereochemical control is crucial for desired biological activity or functional properties.