
Catalog Number	AR01ENQC
Chemical Name	3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-4,4'-diamine sulfate
CAS Number	54827-18-8
Molecular Formula	C16H22N2O4S
Molecular Weight	338.4219
MDL Number	MFCD11113480
SMILES	OS(=O)(=O)O.Cc1cc(cc(c1N)C)c1cc(C)c(c(c1)C)N

3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-4,4'-diamine sulfate, commonly known as $name$, is a versatile compound widely utilized in chemical synthesis. This compound serves as a crucial intermediate in the production of various organic materials, particularly in the field of polymer chemistry. In chemical synthesis, $name$ is valued for its unique structural properties, which allow it to participate in a range of reactions to form complex molecular structures. It is commonly employed as a building block in the synthesis of high-performance polymers, such as conducting polymers and liquid crystalline materials. Moreover, the presence of four methyl groups on the biphenyl backbone confers $name$ with enhanced stability and solubility characteristics, making it a preferred choice for incorporating into novel materials with specific electronic or optical properties. Overall, the application of 3,3',5,5'-Tetramethyl-[1,1'-biphenyl]-4,4'-diamine sulfate in chemical synthesis plays a crucial role in the development of advanced materials with tailored functionalities for various industrial applications.