
Catalog Number	AR00DG2Y
Chemical Name	ETHYL (S)-2-(BENZYLOXY)PROPIONATE
CAS Number	54783-72-1
Molecular Formula	C12H16O3
Molecular Weight	208.2536
MDL Number	MFCD00136861
SMILES	CCOC(=O)[C@H](OCc1ccccc1)C

Propanoic acid, 2-(phenylmethoxy)-, ethyl ester, (2S)- is a versatile compound widely utilized in chemical synthesis for its unique properties and reactivity. This chiral ester can serve as a key building block in various organic reactions, particularly in the formation of complex organic molecules.Its application in chemical synthesis lies in its ability to act as a precursor for the synthesis of pharmaceutical intermediates, agrochemicals, and fine chemicals. The presence of the phenylmethoxy group provides additional functionality and opportunities for selective functionalization, making it a valuable tool in designing and synthesizing intricate molecular structures.Furthermore, the stereochemistry of the (2S)- configuration enhances the selectivity and efficiency of reactions involving this compound, allowing for the production of enantiopure products crucial in pharmaceutical and biological applications. Overall, Propanoic acid, 2-(phenylmethoxy)-, ethyl ester, (2S)- plays a vital role in advancing the field of chemical synthesis by enabling the creation of diverse and complex organic molecules with high precision and control.