
Catalog Number	AR00DGBH
Chemical Name	4-Acetyl-2-methoxyphenyl acetate
CAS Number	54771-60-7
Molecular Formula	C11H12O4
Molecular Weight	208.2106
MDL Number	MFCD00017230
SMILES	COc1cc(ccc1OC(=O)C)C(=O)C

4-Acetyl-2-methoxyphenyl acetate is a versatile compound commonly used in chemical synthesis for its unique properties and diverse applications. This compound serves as a key intermediate in the synthesis of various organic compounds, particularly in the pharmaceutical and fragrance industries. It acts as a crucial building block in the production of complex molecules, allowing chemists to create novel materials with specific properties and functions. In chemical synthesis, 4-Acetyl-2-methoxyphenyl acetate is valued for its reactivity and compatibility with a wide range of other chemical reagents, enabling efficient and controlled reactions to form desired products. Its presence in synthetic pathways contributes to the synthesis of pharmaceuticals, agrochemicals, fragrances, and other high-value compounds, showcasing its significance in modern chemical research and development.