
Catalog Number	AR00DHL2
Chemical Name	Z-BETA-ALA-OME
CAS Number	54755-77-0
Molecular Formula	C12H15NO4
Molecular Weight	237.2518
MDL Number	MFCD00270495
SMILES	COC(=O)CCNC(=O)OCc1ccccc1
NSC Number	657819

Methyl 3-(benzyloxycarbonylamino)propanoate is a versatile compound commonly used in chemical synthesis as a building block for the creation of complex molecules. Its primary application lies in the field of organic chemistry, where it serves as a key intermediate in the synthesis of various pharmaceuticals, agrochemicals, and materials.Due to its unique structure and reactivity, Methyl 3-(benzyloxycarbonylamino)propanoate can participate in a wide range of reactions, such as acylation, amidation, esterification, and more. This flexibility allows chemists to tailor the molecule to suit specific synthetic pathways and efficiently construct diverse chemical structures.In pharmaceutical synthesis, Methyl 3-(benzyloxycarbonylamino)propanoate can be utilized for the preparation of drug candidates by forming crucial amide bonds or introducing functional groups with precision. Its compatibility with different coupling agents and catalysts makes it an invaluable tool for medicinal chemists striving to develop new therapeutic agents.Furthermore, in material science, Methyl 3-(benzyloxycarbonylamino)propanoate can be incorporated into polymerization reactions to modulate the properties of polymers, such as mechanical strength, thermal stability, and biodegradability. This compound's ability to influence polymer structures allows for the design and synthesis of advanced materials with tailored characteristics for specific applications.Overall, the strategic use of Methyl 3-(benzyloxycarbonylamino)propanoate in chemical synthesis enables researchers to access a wide array of molecular architectures and functional materials, advancing innovation in pharmaceuticals, materials science, and beyond.