
Catalog Number	AR00E53L
Chemical Name	trans-4-tert-butyl-cyclohexylaMine hydrochloride
CAS Number	54572-02-0
Molecular Formula	C10H22ClN
Molecular Weight	191.74138000000002
MDL Number	MFCD25371558
SMILES	N[C@@H]1CC[C@H](CC1)C(C)(C)C.Cl

trans-4-(tert-Butyl)cyclohexanamine hydrochloride is a versatile compound commonly used in chemical synthesis as a valuable building block. Its application extends to the synthesis of various pharmaceuticals, agrochemicals, and specialty chemicals. The compound's unique structure, with a tert-butyl group attached to the cyclohexane ring, imparts specific chemical properties that make it particularly useful in the preparation of complex organic molecules. In addition to its role as a chemical intermediate, trans-4-(tert-Butyl)cyclohexanamine hydrochloride also serves as a valuable reagent in the development of novel compounds with diverse applications in the field of organic synthesis and drug discovery.