
Catalog Number	AR00DJ73
Chemical Name	1,3-DI-PIPERIDIN-1-YL-PROPANE-1,3-DIONE
CAS Number	54561-77-2
Molecular Formula	C13H22N2O2
Molecular Weight	238.326
MDL Number	MFCD02715491
SMILES	O=C(N1CCCCC1)CC(=O)N1CCCCC1

The compound 1,3-Di(piperidin-1-yl)propane-1,3-dione, also known as $name$, serves as a valuable reagent in chemical synthesis due to its unique chemical structure and versatile reactivity. In chemical synthesis, $name$ serves as a crucial building block for the preparation of complex organic molecules. Its piperidine functional groups enable it to participate in a variety of reactions, including condensation, alkylation, and reduction reactions. Additionally, $name$ can act as a bridge between different molecular fragments, facilitating the formation of intricate structures and scaffolds in organic synthesis. Its flexible nature allows for the modulation of both steric and electronic properties in the target molecules, making it a valuable tool for designing and accessing new chemical entities.Furthermore, the presence of the carbonyl group in $name$ provides opportunities for further functionalization through reactions such as nucleophilic addition or oxidation, expanding its utility in diverse synthetic pathways. Overall, the application of 1,3-Di(piperidin-1-yl)propane-1,3-dione in chemical synthesis offers chemists a powerful means to construct complex molecules with precision and efficiency.