
Catalog Number	AR00IAF4
Chemical Name	Benzenepropanoic acid, 4-nitro-, methyl ester
CAS Number	54405-42-4
Molecular Formula	C10H11NO4
Molecular Weight	209.1986
MDL Number	MFCD00126837
SMILES	COC(=O)CCc1ccc(cc1)[N+](=O)[O-]

The compound Benzenepropanoic acid, 4-nitro-, methyl ester is commonly utilized in chemical synthesis as a versatile building block for the production of various organic compounds. Its unique molecular structure provides opportunities for diverse reactions and transformations, making it a valuable intermediate in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. This compound can be further modified through functional group interconversions, allowing for the introduction of different substituents to tailor its properties for specific applications. Its reactivity and compatibility with a wide range of reaction conditions make it a valuable tool in the hands of synthetic chemists seeking to access complex molecules efficiently and effectively.