
Catalog Number	AR00DK5K
Chemical Name	(9E,11E,13E)-9,11,13-octadecatrienoic acid
CAS Number	544-73-0
Molecular Formula	C18H30O2
Molecular Weight	278.4296
SMILES	CCCC/C=C/C=C/C=C/CCCCCCCC(=O)O

As a professional chemist, I am pleased to discuss the applications of β-Eleostearic acid in chemical synthesis. This unique compound is essential in various chemical processes due to its distinctive properties.In chemical synthesis, β-Eleostearic acid serves as a versatile building block for the creation of specialized molecules. Its conjugated double bonds make it a valuable precursor in the synthesis of polyunsaturated fatty acids, which play crucial roles in biological systems. The presence of these double bonds also enables β-Eleostearic acid to participate in cross-coupling reactions, facilitating the formation of complex organic structures.Furthermore, β-Eleostearic acid can be utilized in the production of conjugated linoleic acid isomers, which have been studied for their potential health benefits. By incorporating β-Eleostearic acid into synthetic pathways, researchers can access a diverse range of functional molecules with applications in pharmaceuticals, nutraceuticals, and materials science.Overall, the use of β-Eleostearic acid in chemical synthesis highlights its significance in creating novel compounds and advancing scientific research.