
Catalog Number	AR003BUS
Chemical Name	1H-PURINE-2,6(3H,9H)-DITHIONE
CAS Number	5437-25-2
Molecular Formula	C5H4N4S2
Molecular Weight	184.2421
MDL Number	MFCD00871017
SMILES	S=c1[nH]c(=S)c2c([nH]1)[nH]cn2

1H-Purine-2,6(3H,9H)-dithione, also known as $name$, is a versatile compound widely utilized in chemical synthesis. This chemical serves as a key building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and reactivity make it a valuable intermediate in the creation of complex organic molecules. In the realm of chemical synthesis, $name$ plays a crucial role as a sulfur-containing heterocycle, enabling the synthesis of diverse sulfur-containing compounds with important biological and industrial applications. Its ability to participate in various types of reactions, such as nucleophilic substitutions and metal-catalyzed transformations, makes it a valuable tool for organic chemists seeking to construct intricate molecular structures. By incorporating 1H-Purine-2,6(3H,9H)-dithione into their synthetic routes, chemists are able to access a wide range of compounds with diverse functionalities and properties, making it an indispensable component in the toolbox of modern synthetic chemists.