
Catalog Number	AR00D974
Chemical Name	(2,4,7-TRIMETHYL-1H-INDOL-3-YL)-ACETIC ACID
CAS Number	5435-43-8
Molecular Formula	C13H15NO2
Molecular Weight	217.2637
MDL Number	MFCD02664368
SMILES	OC(=O)Cc1c(C)[nH]c2c1c(C)ccc2C
NSC Number	21434

The compound 2-(2,4,7-Trimethyl-1H-indol-3-yl)acetic acid, also known as $name$, plays a crucial role in chemical synthesis as a versatile building block. With its unique structure, this compound is commonly utilized in the preparation of various pharmaceuticals, agrochemicals, and organic materials. In organic synthesis, it serves as a valuable starting material for the creation of indole derivatives, which are important intermediates in the production of numerous bioactive molecules. Additionally, the presence of the acetic acid moiety enables $name$ to participate in various chemical reactions such as esterification, amidation, and reduction, expanding its utility in diverse synthetic pathways. Its application in the synthesis of complex molecules highlights its significance in the field of organic chemistry.