
Catalog Number	AR00E1LI
Chemical Name	methyl 2-hydroxy-4-phenylmethoxy-benzoate
CAS Number	5427-29-2
Molecular Formula	C15H14O4
Molecular Weight	258.2693
MDL Number	MFCD01098916
SMILES	COC(=O)c1ccc(cc1O)OCc1ccccc1
NSC Number	14990

Benzoic acid, 2-hydroxy-4-(phenylmethoxy)-, methyl ester is a versatile compound commonly used in chemical synthesis. This compound exhibits unique properties that make it invaluable in various reactions and processes.In chemical synthesis, Benzoic acid, 2-hydroxy-4-(phenylmethoxy)-, methyl ester is frequently utilized as a key precursor in the production of pharmaceuticals, agrochemicals, and fine chemicals. Its structural composition enables it to participate in a wide range of organic transformations, facilitating the creation of complex molecules with specific functionalities.Furthermore, this compound serves as a crucial building block for the synthesis of heterocyclic compounds, which are prevalent in medicinal chemistry and material science. Its presence in synthetic routes contributes to the formation of biologically active compounds and advanced materials with tailored properties.Overall, the application of Benzoic acid, 2-hydroxy-4-(phenylmethoxy)-, methyl ester in chemical synthesis is instrumental in enabling the efficient and precise construction of diverse molecular structures with significance across various industries.