
Catalog Number	AR00DIV7
Chemical Name	TERT-BUTOXYCARBONYLAMINO-ACETIC ACID BENZYL ESTER
CAS Number	54244-69-8
Molecular Formula	C14H19NO4
Molecular Weight	265.3050
MDL Number	MFCD09032588
SMILES	O=C(CNC(=O)OC(C)(C)C)OCc1ccccc1
NSC Number	617237

Boc-Gly-Obzl, also known as tert-butoxycarbonyl-glycine benzyl ester, is a widely used building block in organic chemistry. It serves as a versatile protecting group in peptide synthesis and other chemical reactions. The Boc (tert-butoxycarbonyl) group is commonly employed to temporarily mask the amino group of amino acids, providing protection during specific chemical transformations. In the case of Boc-Gly-Obzl, the Boc group shields the amino group of glycine while the benzyl ester (Obzl) protects the carboxyl group.This compound finds significant utility in the synthesis of peptides, where precise control over the order of amino acids is crucial. By temporarily blocking specific functional groups with Boc-Gly-Obzl, chemists can manipulate the reactivity of the molecule, allowing for selective reactions to take place. Once the desired chemical transformations have occurred, the protecting groups can be removed under mild conditions to reveal the reactive functional groups for further modifications. This strategy enables the stepwise assembly of complex peptide sequences with high precision and efficiency.Furthermore, the use of Boc-Gly-Obzl extends beyond peptide synthesis to various organic reactions where protection-deprotection strategies are essential. Its compatibility with a wide range of chemical reactions and its ease of removal make it a valuable tool in the toolkit of synthetic chemists aiming to construct intricate molecular structures.