
Catalog Number	AR00IABY
Chemical Name	Benzoic acid, 5-(aminosulfonyl)-4-chloro-2-[(2-furanylmethyl)amino]-
CAS Number	54-31-9
Molecular Formula	C12H11ClN2O5S
Molecular Weight	330.7441
MDL Number	MFCD00010549
SMILES	OC(=O)c1cc(c(cc1NCc1ccco1)Cl)S(=O)(=O)N

The 5-(Aminosulfonyl)-4-chloro-2-[(2-furanylmethyl)amino]benzoic acid is a versatile compound widely utilized in chemical synthesis processes. This compound serves as a key building block in the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and functional groups make it valuable in forming complex molecules with specific biological or industrial properties. In chemical synthesis, this compound can function as a crucial intermediate in the development of novel drug candidates, crop protection agents, or other fine chemicals. Its strategic positioning within chemical frameworks allows for efficient incorporation of multiple functional groups, enabling researchers to modify and optimize molecular structures for desired outcomes. The 5-(Aminosulfonyl)-4-chloro-2-[(2-furanylmethyl)amino]benzoic acid plays a pivotal role in the synthesis of diverse compounds, showcasing its significance in the field of chemistry.