
Catalog Number	AR00DCM8
Chemical Name	H-GLA-OH
CAS Number	53861-57-7
Molecular Formula	C6H9NO6
Molecular Weight	191.1388
MDL Number	MFCD00011673
SMILES	OC(=O)[C@H](CC(C(=O)O)C(=O)O)N

The chemical compound $name$ (H-gla-oh) is a versatile and highly useful tool in chemical synthesis. Its application in organic chemistry is centered around its ability to act as an efficient catalyst, facilitating a wide range of reactions and transformations.$name$ plays a crucial role in promoting various types of chemical reactions, such as oxidation, reduction, and functional group interconversions. Its unique structure and properties enable it to accelerate these reactions, leading to higher reaction rates and improved yields.In addition to its catalytic properties, $name$ can also serve as a key building block in the synthesis of complex organic molecules. By incorporating $name$ into the molecular structure, chemists can introduce specific functional groups or facilitate specific chemical reactions, ultimately enabling the synthesis of diverse and valuable compounds.Overall, the application of $name$ in chemical synthesis offers significant advantages in terms of efficiency, selectivity, and overall synthetic strategy. Its versatility and effectiveness make it a valuable tool for chemists working in a wide range of research areas, from pharmaceuticals and materials science to agrochemicals and beyond.