
Catalog Number	AR00DX9Y
Chemical Name	1H-Benzimidazole,1-methyl-6-nitro-(9CI)
CAS Number	5381-79-3
Molecular Formula	C8H7N3O2
Molecular Weight	177.1601
MDL Number	MFCD00962814
SMILES	[O-][N+](=O)c1cc2c(cc1)ncn2C
NSC Number	12003

1-Methyl-6-nitro-1H-benzimidazole is a valuable compound widely utilized in chemical synthesis due to its versatile applications. In organic chemistry, this compound serves as a key building block for the synthesis of various biologically active molecules and pharmaceuticals. Its unique structure allows for efficient modifications through different functional group transformations, making it a powerful intermediate in synthetic routes. Moreover, 1-Methyl-6-nitro-1H-benzimidazole plays a crucial role in the development of novel materials and agrochemicals, showcasing its significance in diverse areas of chemical research and development.