
Catalog Number	AR019GH5
Chemical Name	Leuprorelin
CAS Number	53714-56-0
Molecular Formula	C59H84N16O12
Molecular Weight	1209.3983
MDL Number	MFCD00167544
SMILES	CCNC(=O)[C@@H]1CCCN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@H](NC(=O)[C@H](Cc1ccc(cc1)O)NC(=O)[C@@H](NC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@@H]1CCC(=O)N1)CO)CC(C)C)CC(C)C)CCCNC(=N)N

PGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHC2H5 is a versatile compound commonly used in chemical synthesis for its unique properties and diverse applications. As a peptide derivative, it plays a crucial role in peptide chemistry by serving as a building block for the synthesis of complex peptides and proteins. Its specific sequence and structure make it an ideal candidate for designing and studying bioactive peptides with enhanced stability and biological activity. In peptide synthesis, PGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHC2H5 can be used as a key intermediate to introduce specific amino acid residues or functional groups to the peptide chain, allowing for precise customization of the final product.Furthermore, the incorporation of PGlu-His-Trp-Ser-Tyr-D-Leu-Leu-Arg-Pro-NHC2H5 in chemical reactions can also lead to the creation of peptide analogs with improved pharmacological properties, such as increased bioavailability and resistance to enzymatic degradation. Its versatility and compatibility with various synthetic strategies make it a valuable tool for researchers and chemists working in the field of organic and peptide synthesis.