
Catalog Number	AR00J0LH
Chemical Name	2-amino-3-(3,5-dibromo-4-hydroxyphenyl)propanoic acid
CAS Number	537-24-6
Molecular Formula	C9H9Br2NO3
Molecular Weight	338.9807
MDL Number	MFCD00691755
SMILES	OC(=O)C(Cc1cc(Br)c(c(c1)Br)O)N

Dibromotyrosine is a valuable compound in chemical synthesis known for its ability to introduce functional groups into organic molecules. This compound plays a key role in various synthetic pathways, particularly in the field of medicinal chemistry and pharmaceuticals. Its unique reactivity allows it to serve as a versatile building block for creating complex organic molecules with specific stereochemical properties. Dibromotyrosine is often used as a precursor for the synthesis of biologically active compounds and natural products. Its strategic incorporation into a molecular structure can significantly impact the compound's overall properties and function. In addition, Dibromotyrosine has found applications in the synthesis of peptide mimetics, which are valuable tools in drug discovery and development.