
Catalog Number	AR00DJOT
Chemical Name	N~1~,N~1~-dimethyl-4-nitro-1,2-benzenediamine
CAS Number	5367-52-2
Molecular Formula	C8H11N3O2
Molecular Weight	181.1918
MDL Number	MFCD11553075
SMILES	CN(c1ccc(cc1N)[N+](=O)[O-])C

N~1~,N~1~-DIMETHYL-4-NITRO-1,2-BENZENEDIAMINE is commonly used in chemical synthesis as a versatile building block in the preparation of various organic compounds. Its unique chemical properties make it a valuable reagent in the creation of pharmaceuticals, agrochemicals, and other fine chemicals. With its nitro and diamine functional groups, this compound is particularly useful in the synthesis of heterocyclic compounds, dyes, and complex organic molecules. Its ability to participate in important reactions such as nitration, reduction, and cyclization makes it a key component in the development of novel chemical structures with diverse applications in the field of organic chemistry.