
Catalog Number	AR00IA9E
Chemical Name	2,3-Pyridinedicarboxylic acid, 5-methyl-
CAS Number	53636-65-0
Molecular Formula	C8H7NO4
Molecular Weight	181.1455
MDL Number	MFCD05662425
SMILES	Cc1cc(C(=O)O)c(nc1)C(=O)O

5-Methylpyridine-2,3-dicarboxylic acid, also known as $name$, is a versatile compound commonly used in chemical synthesis as a building block for various organic compounds. Its unique structure and properties make it a valuable intermediate in the creation of pharmaceuticals, agrochemicals, and specialty chemicals. In organic synthesis, $name$ can serve as a key starting material for the preparation of complex molecules through various reactions such as esterification, condensation, and substitution reactions. Its presence in the synthesis process can lead to the formation of novel compounds with potentially valuable properties in drug discovery, materials science, and other fields. By incorporating $name$ into synthetic pathways, chemists can access a diverse range of chemical structures, enabling the development of new materials and products with enhanced properties and functionalities.