
Catalog Number	AR00DDC2
Chemical Name	6-Chloro-1H-indole-2-carbaldehyde
CAS Number	53590-59-3
Molecular Formula	C9H6ClNO
Molecular Weight	179.603
MDL Number	MFCD11040767
SMILES	O=Cc1cc2c([nH]1)cc(cc2)Cl

6-Chloro-1H-indole-2-carbaldehyde, a versatile chemical compound, finds significant application in various chemical synthesis processes. Its unique molecular structure and reactivity make it a valuable building block for the creation of complex organic molecules in pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, 6-Chloro-1H-indole-2-carbaldehyde serves as a key intermediate for the synthesis of diverse heterocyclic compounds. Its aldehyde functional group allows for further functionalization through various chemical reactions, such as Grignard reactions, nucleophilic additions, and condensation reactions. This compound is particularly useful in the preparation of indole derivatives, which are commonly found in biologically active molecules and natural products.Moreover, the 6-chloro substitution on the indole ring imparts specific reactivity and can be selectively modified to introduce different functional groups at various positions on the molecule. This flexibility in structural modification makes 6-Chloro-1H-indole-2-carbaldehyde a valuable tool for designing and synthesizing novel compounds with desired properties for medicinal chemistry and material science applications.