
Catalog Number	AR01CCC9
Chemical Name	2,4-Diamino-5-(3,4-dimethoxybenzyl)pyrimidine
CAS Number	5355-16-8
Molecular Formula	C13H16N4O2
Molecular Weight	260.2917
MDL Number	MFCD00057349
SMILES	COc1cc(ccc1OC)Cc1cnc(nc1N)N

2,4-Diamino-5-(3,4-dimethoxybenzyl)pyrimidine, also known as $name$, is a versatile compound that finds wide applications in chemical synthesis. It serves as a key intermediate in the preparation of various pharmaceuticals and organic compounds. This compound is particularly valued for its role in the synthesis of heterocyclic compounds, which are essential building blocks in medicinal chemistry. Its unique structure and reactivity make it a valuable tool in the creation of bioactive molecules and drug candidates. By incorporating $name$ into synthetic pathways, chemists can access a diverse array of compounds with potential applications in drug discovery and development.