
Catalog Number	AR00DB1K
Chemical Name	Ethyl 1-trityl-1H-imidazole-4-carboxylate
CAS Number	53525-60-3
Molecular Formula	C25H22N2O2
Molecular Weight	382.4544
MDL Number	MFCD06204799
SMILES	CCOC(=O)c1ncn(c1)C(c1ccccc1)(c1ccccc1)c1ccccc1

Ethyl 1-trityl-1H-imidazole-4-carboxylate is a valuable compound utilized in chemical synthesis as a key building block for the creation of various organic molecules. Its unique structure and reactivity make it a versatile intermediate in the preparation of pharmaceuticals, agrochemicals, and fine chemicals. Specifically, this compound is frequently employed in the synthesis of complex heterocyclic compounds, which are crucial in the development of new drugs and materials. By serving as a precursor in multi-step synthetic pathways, Ethyl 1-trityl-1H-imidazole-4-carboxylate enables chemists to access diverse molecular architectures with tailored properties and functions. Its role in organic synthesis highlights its importance in modern chemical research and product development.