
Catalog Number	AR00DAQR
Chemical Name	4-(4-Chloro-phenyl)-4-oxo-butyric acid ethyl ester
CAS Number	53503-49-4
Molecular Formula	C12H13ClO3
Molecular Weight	240.6828
MDL Number	MFCD00032767
SMILES	CCOC(=O)CCC(=O)c1ccc(cc1)Cl

Ethyl 4-(4-chlorophenyl)-4-oxobutyrate, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique chemical structure allows for the synthesis of complex molecules with specific functional groups and stereochemistry. In organic chemistry, $name$ is frequently employed as a building block in the creation of specialized materials and compounds that have extensive applications in the industry. Its role in chemical synthesis enables the efficient and precise formation of diverse chemical entities, making it an essential component in the synthesis of advanced materials and biologically active compounds.