
Catalog Number	AR019GJE
Chemical Name	Benzoic acid, 4-nitro-2-sulfo-, potassium salt (1:1)
CAS Number	5344-48-9
Molecular Formula	C7H5KNO7S
Molecular Weight	286.2804
MDL Number	MFCD09751290
SMILES	OC(=O)c1ccc(cc1S(=O)(=O)O)N(=O)=O.[K]

Benzoic acid, 4-nitro-2-sulfo-, potassium salt (1:1) is a versatile compound commonly utilized in chemical synthesis as a catalyst for various reactions. This potassium salt plays a crucial role in promoting the formation of new compounds through processes such as esterification, oxidation, and nitration. Its unique chemical properties make it an essential component in the production of pharmaceuticals, dyes, and agrochemicals. Additionally, this compound has shown promising results in the synthesis of specialty chemicals and fine organic intermediates, highlighting its significance in modern chemical research and development.