
Catalog Number	AR00E1EP
Chemical Name	ethyl 1-benzyl-4,5-dioxopyrrolidine-3-carboxylate
CAS Number	5336-50-5
Molecular Formula	C14H15NO4
Molecular Weight	261.2732
MDL Number	MFCD00098219
SMILES	CCOC(=O)C1CN(C(=O)C1=O)Cc1ccccc1
NSC Number	334

Ethyl 1-benzyl-4,5-dioxopyrrolidine-3-carboxylate serves as a versatile intermediate in chemical synthesis, particularly in the field of organic chemistry. Its unique structure and functional groups make it a valuable building block for the creation of various organic compounds. This compound can undergo numerous reactions, including esterification, hydrolysis, and reduction, allowing for the synthesis of a wide range of complex molecules. In addition, its presence in the synthesis of pharmaceuticals, agrochemicals, and advanced materials highlights its significance as a key component in the creation of diverse chemical compounds.