
Catalog Number	AR01B6HM
Chemical Name	(2R)-2-amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride
CAS Number	532987-19-2
Molecular Formula	C9H14ClNO2
Molecular Weight	203.6660
MDL Number	MFCD12758138
SMILES	OC[C@@H](c1cccc(c1)OC)N.Cl

The (2R)-2-amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride is a versatile compound utilized in chemical synthesis for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique structure and properties make it a valuable intermediate in organic chemistry reactions. This compound serves as a key building block for the synthesis of complex molecules due to its chiral nature and functional groups. By incorporating (2R)-2-amino-2-(3-methoxyphenyl)ethan-1-ol hydrochloride into organic reactions, chemists can efficiently access a wide range of structurally diverse compounds with relevant biological activities and potential industrial applications.