
Catalog Number	AR01DQF2
Chemical Name	Benzeneacetic acid, a,a-dichloro-, ethyl ester
CAS Number	5317-66-8
Molecular Formula	C10H10Cl2O2
Molecular Weight	233.0912
MDL Number	MFCD02683874
SMILES	CCOC(=O)C(c1ccccc1)(Cl)Cl

Ethyl α,α-dichlorobenzeneacetate is a versatile compound frequently utilized in chemical synthesis for its unique properties. With its two chlorine atoms attached to the alpha position of the benzene ring in the acetate group, this compound serves as a valuable building block in organic chemistry. Its presence promotes the introduction of functional groups and structural modifications in various chemical reactions. In particular, Ethyl α,α-dichlorobenzeneacetate is commonly employed in the synthesis of pharmaceuticals, agrochemicals, and advanced materials due to its reactivity and ability to facilitate complex molecular structures. This compound plays a crucial role in the development of innovative compounds with diverse applications across industries.