
Catalog Number	AR00DHGR
Chemical Name	(2α,3α)-2,3,19-Trihydroxyurs-12-en-28-oic acid
CAS Number	53155-25-2
Molecular Formula	C30H48O5
Molecular Weight	488.6991199999998
MDL Number	MFCD09970922
SMILES	O[C@@H]1C[C@@]2(C)[C@H](C([C@@H]1O)(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2[C@](C)(O)[C@H](C)CC1)C(=O)O)C

Euscaphic acid, a natural triterpenoid found in certain plant species, serves as a valuable building block in chemical synthesis. Its unique chemical structure and reactivity make it a versatile compound for a variety of applications. In organic chemistry, euscaphic acid can be utilized as a precursor for the synthesis of various derivatives and analogs with potentially enhanced biological activities. Its presence in a synthetic route can allow for the creation of novel compounds with diverse properties, ranging from pharmaceuticals to agrochemicals. Furthermore, the functional groups present in euscaphic acid enable selective modifications, facilitating the design of specific molecular structures for targeted applications. In combination with suitable synthetic methodologies, euscaphic acid plays a key role in the development of new compounds with tailored properties and functionalities.