
Catalog Number	AR00DDNQ
Chemical Name	6-NITRO-2,3-DIHYDRO-1H-INDEN-5-YLAMINE
CAS Number	52957-66-1
Molecular Formula	C9H10N2O2
Molecular Weight	178.1879
MDL Number	MFCD00172125
SMILES	[O-][N+](=O)c1cc2CCCc2cc1N

6-Nitro-2,3-dihydro-1H-inden-5-amine, also known as $name$, is a versatile chemical compound widely used in chemical synthesis. In organic chemistry, this compound serves as a key building block for the synthesis of various biologically active compounds and pharmaceuticals. Its unique structure and reactivity make it a valuable starting material for the preparation of heterocyclic compounds, which are important in drug discovery and development. Additionally, $name$ can be utilized in the synthesis of complex molecules with potential applications in materials science and agrochemicals. Its role as a precursor in the formation of diverse chemical structures highlights its significance in advancing synthetic chemistry methodologies.