
Catalog Number	AR00DAHQ
Chemical Name	Pyridoxamine-5'-phosphate
CAS Number	529-96-4
Molecular Formula	C8H13N2O5P
Molecular Weight	248.173
MDL Number	MFCD00023504
SMILES	NCc1c(COP(=O)(O)O)cnc(c1O)C

Pyridoxamine 5′-phosphate, a derivative of vitamin B6, is a versatile compound widely used in chemical synthesis. This vital molecule serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and properties make it a valuable building block in organic synthesis, facilitating the creation of complex molecules with high efficiency and precision. Scientists and researchers leverage the reactivity and stability of pyridoxamine 5′-phosphate to achieve novel chemical transformations and develop innovative synthetic routes. Additionally, this compound plays a crucial role in the study of enzyme mechanisms and metabolic pathways, making it an indispensable tool in biochemical research and drug discovery efforts. In summary, pyridoxamine 5′-phosphate serves as a cornerstone in modern chemical synthesis, enabling the creation of diverse compounds with significant therapeutic and scientific applications.