
Catalog Number	AR00DFEX
Chemical Name	H-PRO-VAL-OH
CAS Number	52899-09-9
Molecular Formula	C10H18N2O3
Molecular Weight	214.2615
SMILES	CC([C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1)C

H-Pro-Val-OH, also known as N-benzyloxycarbonyl-L-histidyl-L-valine, is a valuable amino acid derivative widely used in chemical synthesis. This compound plays a crucial role in peptide synthesis due to its ability to act as a peptide coupler. Specifically, H-Pro-Val-OH is utilized in the formation of peptide bonds between amino acids in a stepwise manner, leading to the creation of complex peptides with specific sequences.Additionally, H-Pro-Val-OH serves as a protecting group for the histidine amino acid, shielding it from unwanted reactions during peptide assembly. This protection allows for precise control over the peptide synthesis process and ensures the desired peptide sequence is obtained. Furthermore, the valine moiety in H-Pro-Val-OH contributes to the overall structure and properties of the synthesized peptides.In summary, H-Pro-Val-OH is a versatile compound that finds applications in the synthesis of peptides with tailored sequences and properties. Its role as a peptide coupler and protecting group makes it an essential component in the field of chemical synthesis and peptide chemistry.