
Catalog Number	AR00DFTS
Chemical Name	DESETHYLENE CIPROFLOXACIN, HYDROCHLORIDE
CAS Number	528851-31-2
Molecular Formula	C15H17ClFN3O3
Molecular Weight	341.7652
MDL Number	MFCD09836204
SMILES	NCCNc1cc2c(cc1F)c(=O)c(cn2C1CC1)C(=O)O.Cl

The compound $name$ is a versatile molecule commonly used in chemical synthesis due to its unique properties. In particular, its functionality as a fluoroquinolone antibiotic makes it a valuable reagent in the development of novel drug candidates for combating bacterial infections. By incorporating $name$ into synthetic routes, chemists can fine-tune the structure-activity relationships of potential antibiotics, enhancing their efficacy and specificity against a wide range of bacteria. Additionally, the presence of the cyclopropyl group in $name$ confers structural rigidity, which can be exploited to design molecules with improved pharmacokinetic properties and resistance to enzymatic degradation. Overall, the application of 7-((2-Aminoethyl)amino)-1-cyclopropyl-6-fluoro-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride in chemical synthesis offers a promising avenue for the development of next-generation antibacterial agents.