
Catalog Number	AR003DDP
Chemical Name	(S)-XYL-SDP
CAS Number	528521-89-3
Molecular Formula	C98H100P4
Molecular Weight	1401.7376
MDL Number	MFCD08459343
SMILES	Cc1cc(C)cc(c1)P(c1cccc2c1C1(CC2)CCc2c1c(ccc2)P(c1cc(C)cc(c1)C)c1cc(C)cc(c1)C)c1cc(C)cc(c1)C.Cc1cc(C)cc(c1)P(c1cccc2c1C1(CC2)CCc2c1c(ccc2)P(c1cc(C)cc(c1)C)c1cc(C)cc(c1)C)c1cc(C)cc(c1)C

(S)-Xyl-SDP, or (S)-Xyl-SpiroCPA, is a versatile chiral building block used in chemical synthesis due to its unique stereochemical properties. This compound is a spirocyclic phosphoric acid derivative that serves as an efficient catalyst for a variety of asymmetric transformations. It is particularly valued for its ability to catalyze challenging asymmetrical reactions with high enantioselectivity.One prominent application of (S)-Xyl-SDP is its use in the enantioselective synthesis of biologically active compounds and pharmaceutical intermediates. By leveraging the chiral environment offered by this compound, chemists can control the stereochemistry of key reactive intermediates, leading to the production of optically pure molecules essential for drug discovery and development.Furthermore, (S)-Xyl-SDP has found utility in the construction of complex natural products with intricate molecular architectures. Its ability to catalyze various bond-forming reactions in a selective manner makes it a valuable tool for synthetic chemists aiming to access structurally diverse compounds through concise and efficient synthetic routes.In summary, (S)-Xyl-SDP plays a pivotal role in modern chemical synthesis by enabling the construction of intricate molecules with high stereochemical control. Its versatile nature and excellent enantioselectivity make it a valuable asset in the toolkit of organic chemists striving to access new compounds and push the boundaries of synthetic methodology.