
Catalog Number	AR00DFQE
Chemical Name	2-(4-Chloro-3-Sulphamoylbenzoyl)Benzoic Acid
CAS Number	5270-74-6
Molecular Formula	C14H10ClNO5S
Molecular Weight	339.7509
MDL Number	MFCD09753828
SMILES	O=C(c1ccccc1C(=O)O)c1ccc(c(c1)S(=O)(=O)N)Cl

2-(4-Chloro-3-sulfamoylbenzoyl)benzoic acid is a versatile compound widely used in chemical synthesis as a key intermediate. It plays a crucial role in the preparation of various pharmaceuticals, agrochemicals, and advanced materials. This compound serves as a building block for the synthesis of complex molecules due to its unique structural features and reactivity. In the field of medicinal chemistry, it is utilized for the development of novel drugs with enhanced pharmacological properties. Its presence in the synthesis of agrochemicals aids in the production of effective pesticides and herbicides. Additionally, in materials science, this compound is employed for the creation of innovative materials with tailored properties. Overall, the application of 2-(4-Chloro-3-sulfamoylbenzoyl)benzoic acid in chemical synthesis underscores its significance in advancing various scientific disciplines.