
Catalog Number	AR00DFN1
Chemical Name	ERYTHROMYCIN B (150 MG)
CAS Number	527-75-3
Molecular Formula	C37H67NO12
Molecular Weight	717.9274
MDL Number	MFCD01729130
SMILES	CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@H]([C@@H](O2)C)O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@@H]([C@H]2O)N(C)C)[C@](C[C@H](C(=O)[C@@H]([C@H]([C@H]1C)O)C)C)(C)O

Erythromycin B, a derivative of the antibiotic erythromycin, finds significant application in chemical synthesis as a powerful tool for the selective oxidation of alcohols. Its unique structural properties allow it to act as a catalyst in various oxidation reactions, transforming primary and secondary alcohols into corresponding aldehydes and ketones with excellent yields and high chemo-selectivity. This ability makes Erythromycin B a valuable reagent in the preparation of various organic compounds, pharmaceutical intermediates, and natural product synthesis. Its efficacy in facilitating these transformations underscores its role as a versatile and indispensable reagent in the realm of chemical synthesis.